C24H50N2O6 — CID 163495040
3-methyl-1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one (PubChem CID 163495040) has the molecular formula C24H50N2O6 and a molecular weight of 462.67 g/mol. Its IUPAC name is 3-methyl-1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one.
| Compound Name | 3-methyl-1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one |
|---|---|
| PubChem CID | 163495040 |
| Molecular Formula | C24H50N2O6 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | 3-methyl-1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one |
| SMILES | CC(C)NCCOCCOCC(=O)C(C)C.CC(C)NCCOCCOCC(=O)C(C)C |
| InChI | InChI=1S/2C12H25NO3/c2*1-10(2)12(14)9-16-8-7-15-6-5-13-11(3)4/h2*10-11,13H,5-9H2,1-4H3 |
| InChIKey | CPYMFQGIFPQEPP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|