C15H31NO4 — CID 135299160
4-methyl-1-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]pentan-3-one (PubChem CID 135299160) has the molecular formula C15H31NO4 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-methyl-1-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]pentan-3-one.
| Compound Name | 4-methyl-1-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]pentan-3-one |
|---|---|
| PubChem CID | 135299160 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 4-methyl-1-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]pentan-3-one |
| SMILES | CC(C)NCCOCCOCCOCCC(=O)C(C)C |
| InChI | InChI=1S/C15H31NO4/c1-13(2)15(17)5-7-18-9-11-20-12-10-19-8-6-16-14(3)4/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | IEYGYZSNTAWVBO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|