C16H31NO5 — CID 142398269
5-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]pent-1-en-3-one (PubChem CID 142398269) has the molecular formula C16H31NO5 and a molecular weight of 317.43 g/mol. Its IUPAC name is 5-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]pent-1-en-3-one.
| Compound Name | 5-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]pent-1-en-3-one |
|---|---|
| PubChem CID | 142398269 |
| Molecular Formula | C16H31NO5 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 5-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]pent-1-en-3-one |
| SMILES | C=CC(=O)CCOCCOCCOCCOCCNC(C)C |
| InChI | InChI=1S/C16H31NO5/c1-4-16(18)5-7-19-9-11-21-13-14-22-12-10-20-8-6-17-15(2)3/h4,15,17H,1,5-14H2,2-3H3 |
| InChIKey | VMAFCEXIRMXAEX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|