C19H40N2O6 — CID 138727326
2-methyl-N-[2-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 138727326) has the molecular formula C19H40N2O6 and a molecular weight of 392.54 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 138727326 |
| Molecular Formula | C19H40N2O6 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC(C)NCCOCCOCCOCCOCCOCCNC(=O)C(C)C |
| InChI | InChI=1S/C19H40N2O6/c1-17(2)19(22)21-6-8-24-10-12-26-14-16-27-15-13-25-11-9-23-7-5-20-18(3)4/h17-18,20H,5-16H2,1-4H3,(H,21,22) |
| InChIKey | DYIWMQFEDVGDLB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|