C14H29NO4 — CID 176578249
ethane;2-methyl-N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]propanamide (PubChem CID 176578249) has the molecular formula C14H29NO4 and a molecular weight of 275.39 g/mol. Its IUPAC name is ethane;2-methyl-N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]propanamide.
| Compound Name | ethane;2-methyl-N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 176578249 |
| Molecular Formula | C14H29NO4 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | ethane;2-methyl-N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]propanamide |
| SMILES | CC.CC(=O)CCOCCOCCNC(=O)C(C)C |
| InChI | InChI=1S/C12H23NO4.C2H6/c1-10(2)12(15)13-5-7-17-9-8-16-6-4-11(3)14;1-2/h10H,4-9H2,1-3H3,(H,13,15);1-2H3 |
| InChIKey | YNURXXCSRHYUPU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|