C21H41NO7 — CID 167576629
2-methyl-N-[2-[2-[2-[2-[2-(5-methyl-2-oxohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 167576629) has the molecular formula C21H41NO7 and a molecular weight of 419.56 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-[2-[2-(5-methyl-2-oxohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[2-[2-[2-[2-(5-methyl-2-oxohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 167576629 |
| Molecular Formula | C21H41NO7 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-[2-[2-(5-methyl-2-oxohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC(C)CCC(=O)COCCOCCOCCOCCOCCNC(=O)C(C)C |
| InChI | InChI=1S/C21H41NO7/c1-18(2)5-6-20(23)17-29-16-15-28-14-13-27-12-11-26-10-9-25-8-7-22-21(24)19(3)4/h18-19H,5-17H2,1-4H3,(H,22,24) |
| InChIKey | GPUYAERLWORTCB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|