C20H45NO5 — CID 171565273
ethane;N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 171565273) has the molecular formula C20H45NO5 and a molecular weight of 379.58 g/mol. Its IUPAC name is ethane;N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | ethane;N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 171565273 |
| Molecular Formula | C20H45NO5 |
| Molecular Weight | 379.58 g/mol |
| Exact Mass | 379.33 |
| IUPAC Name | ethane;N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC.CC.CCC(=O)NCCOCCOCCOCCOCCC(C)C |
| InChI | InChI=1S/C16H33NO5.2C2H6/c1-4-16(18)17-6-8-20-10-12-22-14-13-21-11-9-19-7-5-15(2)3;2*1-2/h15H,4-14H2,1-3H3,(H,17,18);2*1-2H3 |
| InChIKey | JFJZHFWTPFLAKJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|