C14H25NO3 — CID 176933394
N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]pent-4-ynamide (PubChem CID 176933394) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]pent-4-ynamide.
| Compound Name | N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]pent-4-ynamide |
|---|---|
| PubChem CID | 176933394 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]pent-4-ynamide |
| SMILES | C#CCCC(=O)NCCOCCOCCC(C)C |
| InChI | InChI=1S/C14H25NO3/c1-4-5-6-14(16)15-8-10-18-12-11-17-9-7-13(2)3/h1,13H,5-12H2,2-3H3,(H,15,16) |
| InChIKey | XTPQSVAZPVHATO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|