C18H38N2O6 — CID 162756086
N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-methylpentanamide (PubChem CID 162756086) has the molecular formula C18H38N2O6 and a molecular weight of 378.51 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-methylpentanamide.
| Compound Name | N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 162756086 |
| Molecular Formula | C18H38N2O6 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NCCOCCOCCOCCOCCOCCN |
| InChI | InChI=1S/C18H38N2O6/c1-17(2)3-4-18(21)20-6-8-23-10-12-25-14-16-26-15-13-24-11-9-22-7-5-19/h17H,3-16,19H2,1-2H3,(H,20,21) |
| InChIKey | BFFLFOPOAFRYRI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|