C12H28N2O10P2 — CID 59449890
[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid (PubChem CID 59449890) has the molecular formula C12H28N2O10P2 and a molecular weight of 422.31 g/mol. Its IUPAC name is [4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid.
| Compound Name | [4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 59449890 |
| Molecular Formula | C12H28N2O10P2 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | [4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid |
| SMILES | NCCOCCOCCOCCNC(=O)CCC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H28N2O10P2/c13-3-5-22-7-9-24-10-8-23-6-4-14-11(15)1-2-12(25(16,17)18)26(19,20)21/h12H,1-10,13H2,(H,14,15)(H2,16,17,18)(H2,19,20,21) |
| InChIKey | LXMDDEIBAJJNGP-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 197.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|