C9H21NO9P2 — CID 59449901
[4-[2-(2-methoxyethoxy)ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid (PubChem CID 59449901) has the molecular formula C9H21NO9P2 and a molecular weight of 349.21 g/mol. Its IUPAC name is [4-[2-(2-methoxyethoxy)ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid.
| Compound Name | [4-[2-(2-methoxyethoxy)ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 59449901 |
| Molecular Formula | C9H21NO9P2 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [4-[2-(2-methoxyethoxy)ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid |
| SMILES | COCCOCCNC(=O)CCC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H21NO9P2/c1-18-6-7-19-5-4-10-8(11)2-3-9(20(12,13)14)21(15,16)17/h9H,2-7H2,1H3,(H,10,11)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | OOOBZONHWHPNFW-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|