C10H23ClN2O3 — CID 119498989
N-(3-aminobutyl)-3-(2-methoxyethoxy)propanamide;hydrochloride (PubChem CID 119498989) has the molecular formula C10H23ClN2O3 and a molecular weight of 254.76 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-(2-methoxyethoxy)propanamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-3-(2-methoxyethoxy)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119498989 |
| Molecular Formula | C10H23ClN2O3 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-(3-aminobutyl)-3-(2-methoxyethoxy)propanamide;hydrochloride |
| SMILES | COCCOCCC(=O)NCCC(C)N.Cl |
| InChI | InChI=1S/C10H22N2O3.ClH/c1-9(11)3-5-12-10(13)4-6-15-8-7-14-2;/h9H,3-8,11H2,1-2H3,(H,12,13);1H |
| InChIKey | LBOWTLCIABUUIV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|