C17H36N3O4+ — CID 168911379
2-[2-[3-[[(3S)-3-amino-5-methyl-4-oxohexyl]amino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium (PubChem CID 168911379) has the molecular formula C17H36N3O4+ and a molecular weight of 346.49 g/mol. Its IUPAC name is 2-[2-[3-[[(3S)-3-amino-5-methyl-4-oxohexyl]amino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium.
| Compound Name | 2-[2-[3-[[(3S)-3-amino-5-methyl-4-oxohexyl]amino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 168911379 |
| Molecular Formula | C17H36N3O4+ |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 2-[2-[3-[[(3S)-3-amino-5-methyl-4-oxohexyl]amino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium |
| SMILES | CC(C)C(=O)[C@@H](N)CCNC(=O)CCOCCOCC[N+](C)(C)C |
| InChI | InChI=1S/C17H35N3O4/c1-14(2)17(22)15(18)6-8-19-16(21)7-10-23-12-13-24-11-9-20(3,4)5/h14-15H,6-13,18H2,1-5H3/p+1/t15-/m0/s1 |
| InChIKey | IMZORNBXUHMWSI-HNNXBMFYSA-O |
| XLogP | 0.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|