C21H41N5O6 — CID 168852497
(2S)-2-amino-N,N'-bis[2-[2-(butanoylamino)ethoxy]ethyl]pentanediamide (PubChem CID 168852497) has the molecular formula C21H41N5O6 and a molecular weight of 459.59 g/mol. Its IUPAC name is (2S)-2-amino-N,N'-bis[2-[2-(butanoylamino)ethoxy]ethyl]pentanediamide.
| Compound Name | (2S)-2-amino-N,N'-bis[2-[2-(butanoylamino)ethoxy]ethyl]pentanediamide |
|---|---|
| PubChem CID | 168852497 |
| Molecular Formula | C21H41N5O6 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | (2S)-2-amino-N,N'-bis[2-[2-(butanoylamino)ethoxy]ethyl]pentanediamide |
| SMILES | CCCC(=O)NCCOCCNC(=O)CC[C@H](N)C(=O)NCCOCCNC(=O)CCC |
| InChI | InChI=1S/C21H41N5O6/c1-3-5-18(27)23-9-13-31-15-11-25-20(29)8-7-17(22)21(30)26-12-16-32-14-10-24-19(28)6-4-2/h17H,3-16,22H2,1-2H3,(H,23,27)(H,24,28)(H,25,29)(H,26,30)/t17-/m0/s1 |
| InChIKey | OHRHFNIZVUNIJK-KRWDZBQOSA-N |
| XLogP | -0.81 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|