C10H20N2O5 — CID 64890122
4-amino-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoic acid (PubChem CID 64890122) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-amino-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 64890122 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-amino-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoic acid |
| SMILES | COCCOCCNC(=O)C(N)CCC(=O)O |
| InChI | InChI=1S/C10H20N2O5/c1-16-6-7-17-5-4-12-10(15)8(11)2-3-9(13)14/h8H,2-7,11H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | LSOVPUCJYHRPOO-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|