C15H33N3O5 — CID 141222319
(2S)-2,6-diamino-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide (PubChem CID 141222319) has the molecular formula C15H33N3O5 and a molecular weight of 335.45 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 141222319 |
| Molecular Formula | C15H33N3O5 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide |
| SMILES | COCCOCCOCCOCCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C15H33N3O5/c1-20-8-9-22-12-13-23-11-10-21-7-6-18-15(19)14(17)4-2-3-5-16/h14H,2-13,16-17H2,1H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | YFOSVNWFTSTHNN-AWEZNQCLSA-N |
| XLogP | -0.74 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|