C8H19N3O2 — CID 166782111
(2S)-2,6-diamino-N-(methoxymethyl)hexanamide (PubChem CID 166782111) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-(methoxymethyl)hexanamide.
| Compound Name | (2S)-2,6-diamino-N-(methoxymethyl)hexanamide |
|---|---|
| PubChem CID | 166782111 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (2S)-2,6-diamino-N-(methoxymethyl)hexanamide |
| SMILES | COCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C8H19N3O2/c1-13-6-11-8(12)7(10)4-2-3-5-9/h7H,2-6,9-10H2,1H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | WJMADZOFVHKADK-ZETCQYMHSA-N |
| XLogP | -0.84 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|