C12H23N3O4 — CID 10649088
methyl 5-[[(2S)-2,6-diaminohexanoyl]amino]-4-oxopentanoate (PubChem CID 10649088) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl 5-[[(2S)-2,6-diaminohexanoyl]amino]-4-oxopentanoate.
| Compound Name | methyl 5-[[(2S)-2,6-diaminohexanoyl]amino]-4-oxopentanoate |
|---|---|
| PubChem CID | 10649088 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | methyl 5-[[(2S)-2,6-diaminohexanoyl]amino]-4-oxopentanoate |
| SMILES | COC(=O)CCC(=O)CNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C12H23N3O4/c1-19-11(17)6-5-9(16)8-15-12(18)10(14)4-2-3-7-13/h10H,2-8,13-14H2,1H3,(H,15,18)/t10-/m0/s1 |
| InChIKey | XCGVMQPITLPCCM-JTQLQIEISA-N |
| XLogP | -0.92 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|