C9H21Cl2N3O3 — CID 87503662
3-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid;dihydrochloride (PubChem CID 87503662) has the molecular formula C9H21Cl2N3O3 and a molecular weight of 290.19 g/mol. Its IUPAC name is 3-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid;dihydrochloride.
| Compound Name | 3-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 87503662 |
| Molecular Formula | C9H21Cl2N3O3 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NCCCC[C@H](N)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C9H19N3O3.2ClH/c10-5-2-1-3-7(11)9(15)12-6-4-8(13)14;;/h7H,1-6,10-11H2,(H,12,15)(H,13,14);2*1H/t7-;;/m0../s1 |
| InChIKey | PXQDJQSWBSTJQR-KLXURFKVSA-N |
| XLogP | -0.12 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|