C9H20Cl2N3O3- — CID 18763805
3-(2,6-diaminohexanoylamino)propanoate;dihydrochloride (PubChem CID 18763805) has the molecular formula C9H20Cl2N3O3- and a molecular weight of 289.18 g/mol. Its IUPAC name is 3-(2,6-diaminohexanoylamino)propanoate;dihydrochloride.
| Compound Name | 3-(2,6-diaminohexanoylamino)propanoate;dihydrochloride |
|---|---|
| PubChem CID | 18763805 |
| Molecular Formula | C9H20Cl2N3O3- |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-(2,6-diaminohexanoylamino)propanoate;dihydrochloride |
| SMILES | Cl.Cl.NCCCCC(N)C(=O)NCCC(=O)[O-] |
| InChI | InChI=1S/C9H19N3O3.2ClH/c10-5-2-1-3-7(11)9(15)12-6-4-8(13)14;;/h7H,1-6,10-11H2,(H,12,15)(H,13,14);2*1H/p-1 |
| InChIKey | PXQDJQSWBSTJQR-UHFFFAOYSA-M |
| XLogP | -1.46 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|