C18H40N6O2 — CID 100984594
(2S)-2,6-diamino-N-[6-[[(2S)-2,6-diaminohexanoyl]amino]hexyl]hexanamide (PubChem CID 100984594) has the molecular formula C18H40N6O2 and a molecular weight of 372.56 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[6-[[(2S)-2,6-diaminohexanoyl]amino]hexyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[6-[[(2S)-2,6-diaminohexanoyl]amino]hexyl]hexanamide |
|---|---|
| PubChem CID | 100984594 |
| Molecular Formula | C18H40N6O2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.32 |
| IUPAC Name | (2S)-2,6-diamino-N-[6-[[(2S)-2,6-diaminohexanoyl]amino]hexyl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)NCCCCCCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C18H40N6O2/c19-11-5-3-9-15(21)17(25)23-13-7-1-2-8-14-24-18(26)16(22)10-4-6-12-20/h15-16H,1-14,19-22H2,(H,23,25)(H,24,26)/t15-,16-/m0/s1 |
| InChIKey | XIJSVSFVLISWIS-HOTGVXAUSA-N |
| XLogP | -0.31 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|