C14H33N5O — CID 11022527
(2S)-2,6-diamino-N-[4-(4-aminobutylamino)butyl]hexanamide (PubChem CID 11022527) has the molecular formula C14H33N5O and a molecular weight of 287.45 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[4-(4-aminobutylamino)butyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[4-(4-aminobutylamino)butyl]hexanamide |
|---|---|
| PubChem CID | 11022527 |
| Molecular Formula | C14H33N5O |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.27 |
| IUPAC Name | (2S)-2,6-diamino-N-[4-(4-aminobutylamino)butyl]hexanamide |
| SMILES | NCCCCNCCCCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C14H33N5O/c15-8-2-1-7-13(17)14(20)19-12-6-5-11-18-10-4-3-9-16/h13,18H,1-12,15-17H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | UXDOEBXDHGATJE-ZDUSSCGKSA-N |
| XLogP | -0.33 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|