C13H31N7O — CID 10881162
(2S)-2-amino-N-[4-(3-aminopropylamino)butyl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 10881162) has the molecular formula C13H31N7O and a molecular weight of 301.44 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-(3-aminopropylamino)butyl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-amino-N-[4-(3-aminopropylamino)butyl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 10881162 |
| Molecular Formula | C13H31N7O |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | (2S)-2-amino-N-[4-(3-aminopropylamino)butyl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | NCCCNCCCCNC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C13H31N7O/c14-6-4-8-18-7-1-2-9-19-12(21)11(15)5-3-10-20-13(16)17/h11,18H,1-10,14-15H2,(H,19,21)(H4,16,17,20)/t11-/m0/s1 |
| InChIKey | GWVZWXCPXCWJHU-NSHDSACASA-N |
| XLogP | -1.80 |
| TPSA | 157.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|