C20H46N6O — CID 23400711
2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(butylamino)hexanamide (PubChem CID 23400711) has the molecular formula C20H46N6O and a molecular weight of 386.63 g/mol. Its IUPAC name is 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(butylamino)hexanamide.
| Compound Name | 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(butylamino)hexanamide |
|---|---|
| PubChem CID | 23400711 |
| Molecular Formula | C20H46N6O |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.37 |
| IUPAC Name | 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(butylamino)hexanamide |
| SMILES | CCCCNCCCCC(N)C(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C20H46N6O/c1-2-3-12-23-13-5-4-10-19(22)20(27)26-18-9-17-25-15-7-6-14-24-16-8-11-21/h19,23-25H,2-18,21-22H2,1H3,(H,26,27) |
| InChIKey | JWXCGHXMCJNSIE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|