C13H31N5O2 — CID 10924229
(2S)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-hydroxypropanamide (PubChem CID 10924229) has the molecular formula C13H31N5O2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-hydroxypropanamide.
| Compound Name | (2S)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 10924229 |
| Molecular Formula | C13H31N5O2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | (2S)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-hydroxypropanamide |
| SMILES | NCCCNCCCCNCCCNC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C13H31N5O2/c14-5-3-8-16-6-1-2-7-17-9-4-10-18-13(20)12(15)11-19/h12,16-17,19H,1-11,14-15H2,(H,18,20)/t12-/m0/s1 |
| InChIKey | JFJDIACJXJZSAV-LBPRGKRZSA-N |
| XLogP | -1.88 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|