C14H32N4O — CID 154982765
N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-methylpropanamide (PubChem CID 154982765) has the molecular formula C14H32N4O and a molecular weight of 272.44 g/mol. Its IUPAC name is N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-methylpropanamide.
| Compound Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 154982765 |
| Molecular Formula | C14H32N4O |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.26 |
| IUPAC Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C14H32N4O/c1-13(2)14(19)18-12-6-11-17-9-4-3-8-16-10-5-7-15/h13,16-17H,3-12,15H2,1-2H3,(H,18,19) |
| InChIKey | CEIXTAHWGXFNFA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|