C13H30N4O — CID 154594320
N-[3-[3-(3-aminopropylamino)propylamino]propyl]-2-methylpropanamide (PubChem CID 154594320) has the molecular formula C13H30N4O and a molecular weight of 258.41 g/mol. Its IUPAC name is N-[3-[3-(3-aminopropylamino)propylamino]propyl]-2-methylpropanamide.
| Compound Name | N-[3-[3-(3-aminopropylamino)propylamino]propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 154594320 |
| Molecular Formula | C13H30N4O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | N-[3-[3-(3-aminopropylamino)propylamino]propyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCCNCCCNCCCN |
| InChI | InChI=1S/C13H30N4O/c1-12(2)13(18)17-11-5-10-16-9-4-8-15-7-3-6-14/h12,15-16H,3-11,14H2,1-2H3,(H,17,18) |
| InChIKey | FYSFOADJDFOTHX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|