C7H16N2O2 — CID 168915503
N-(3-aminopropyl)-3-hydroxy-2-methylpropanamide (PubChem CID 168915503) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-hydroxy-2-methylpropanamide.
| Compound Name | N-(3-aminopropyl)-3-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 168915503 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | N-(3-aminopropyl)-3-hydroxy-2-methylpropanamide |
| SMILES | CC(CO)C(=O)NCCCN |
| InChI | InChI=1S/C7H16N2O2/c1-6(5-10)7(11)9-4-2-3-8/h6,10H,2-5,8H2,1H3,(H,9,11) |
| InChIKey | GBTNVCHJDWFLFW-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|