C9H20N2O6 — CID 23193776
N-(3-aminopropyl)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 23193776) has the molecular formula C9H20N2O6 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-(3-aminopropyl)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | N-(3-aminopropyl)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 23193776 |
| Molecular Formula | C9H20N2O6 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N-(3-aminopropyl)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | NCCCNC(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C9H20N2O6/c10-2-1-3-11-9(17)8(16)7(15)6(14)5(13)4-12/h5-8,12-16H,1-4,10H2,(H,11,17) |
| InChIKey | WANUZURDHBNKFN-UHFFFAOYSA-N |
| XLogP | -4.11 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|