C11H23NO7 — CID 124819757
(2R,3R,4R,5R,6S)-N-butyl-2,3,4,5,6,7-hexahydroxyheptanamide (PubChem CID 124819757) has the molecular formula C11H23NO7 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-N-butyl-2,3,4,5,6,7-hexahydroxyheptanamide.
| Compound Name | (2R,3R,4R,5R,6S)-N-butyl-2,3,4,5,6,7-hexahydroxyheptanamide |
|---|---|
| PubChem CID | 124819757 |
| Molecular Formula | C11H23NO7 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (2R,3R,4R,5R,6S)-N-butyl-2,3,4,5,6,7-hexahydroxyheptanamide |
| SMILES | CCCCNC(=O)[C@H](O)[C@H](O)[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C11H23NO7/c1-2-3-4-12-11(19)10(18)9(17)8(16)7(15)6(14)5-13/h6-10,13-18H,2-5H2,1H3,(H,12,19)/t6-,7+,8+,9+,10+/m0/s1 |
| InChIKey | DIEBNAGWFVUKAR-VAPHQMJDSA-N |
| XLogP | -3.30 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|