C8H16BrNO6 — CID 117069356
N-(2-bromoethyl)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 117069356) has the molecular formula C8H16BrNO6 and a molecular weight of 302.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | N-(2-bromoethyl)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 117069356 |
| Molecular Formula | C8H16BrNO6 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | N-(2-bromoethyl)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | O=C(NCCBr)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H16BrNO6/c9-1-2-10-8(16)7(15)6(14)5(13)4(12)3-11/h4-7,11-15H,1-3H2,(H,10,16) |
| InChIKey | RAOKOEZEEIJHKG-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|