C17H35N3O12 — CID 58472211
2,3,4,5,6-pentahydroxy-N-[2-[methyl-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyl]amino]ethyl]hexanamide (PubChem CID 58472211) has the molecular formula C17H35N3O12 and a molecular weight of 473.48 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxy-N-[2-[methyl-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyl]amino]ethyl]hexanamide.
| Compound Name | 2,3,4,5,6-pentahydroxy-N-[2-[methyl-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyl]amino]ethyl]hexanamide |
|---|---|
| PubChem CID | 58472211 |
| Molecular Formula | C17H35N3O12 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2,3,4,5,6-pentahydroxy-N-[2-[methyl-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyl]amino]ethyl]hexanamide |
| SMILES | CN(CCNC(=O)C(O)C(O)C(O)C(O)CO)CCNC(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C17H35N3O12/c1-20(4-2-18-16(31)14(29)12(27)10(25)8(23)6-21)5-3-19-17(32)15(30)13(28)11(26)9(24)7-22/h8-15,21-30H,2-7H2,1H3,(H,18,31)(H,19,32) |
| InChIKey | RWSIAMUBRBPAJN-UHFFFAOYSA-N |
| XLogP | -7.98 |
| TPSA | 263.74 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | -7.98 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |