C8H17NO6 — CID 138650369
(3S,4R)-N-ethyl-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 138650369) has the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. Its IUPAC name is (3S,4R)-N-ethyl-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (3S,4R)-N-ethyl-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 138650369 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (3S,4R)-N-ethyl-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CCNC(=O)C(O)[C@@H](O)[C@H](O)C(O)CO |
| InChI | InChI=1S/C8H17NO6/c1-2-9-8(15)7(14)6(13)5(12)4(11)3-10/h4-7,10-14H,2-3H2,1H3,(H,9,15)/t4?,5-,6+,7?/m1/s1 |
| InChIKey | CEUIEPMYCRNXIZ-LFCOQJFYSA-N |
| XLogP | -3.44 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |