C7H15NO5 — CID 91224788
(2R,3R,4R)-N-ethyl-2,3,4,5-tetrahydroxypentanamide (PubChem CID 91224788) has the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. Its IUPAC name is (2R,3R,4R)-N-ethyl-2,3,4,5-tetrahydroxypentanamide.
| Compound Name | (2R,3R,4R)-N-ethyl-2,3,4,5-tetrahydroxypentanamide |
|---|---|
| PubChem CID | 91224788 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (2R,3R,4R)-N-ethyl-2,3,4,5-tetrahydroxypentanamide |
| SMILES | CCNC(=O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15NO5/c1-2-8-7(13)6(12)5(11)4(10)3-9/h4-6,9-12H,2-3H2,1H3,(H,8,13)/t4-,5-,6-/m1/s1 |
| InChIKey | ASKIJFFPUHVGAJ-HSUXUTPPSA-N |
| XLogP | -2.80 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |