C17H34N2O6 — CID 57405064
N-[2-[[(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoyl]amino]ethyl]decanamide (PubChem CID 57405064) has the molecular formula C17H34N2O6 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-[2-[[(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoyl]amino]ethyl]decanamide.
| Compound Name | N-[2-[[(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoyl]amino]ethyl]decanamide |
|---|---|
| PubChem CID | 57405064 |
| Molecular Formula | C17H34N2O6 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | N-[2-[[(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoyl]amino]ethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCCNC(=O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H34N2O6/c1-2-3-4-5-6-7-8-9-14(22)18-10-11-19-17(25)16(24)15(23)13(21)12-20/h13,15-16,20-21,23-24H,2-12H2,1H3,(H,18,22)(H,19,25)/t13-,15-,16-/m1/s1 |
| InChIKey | HKBATPXRIREBKJ-FVQBIDKESA-N |
| XLogP | -0.57 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|