C12H23NO7 — CID 141176640
(2R,3S,4R,5R)-N-hexanoyl-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 141176640) has the molecular formula C12H23NO7 and a molecular weight of 293.32 g/mol. Its IUPAC name is (2R,3S,4R,5R)-N-hexanoyl-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2R,3S,4R,5R)-N-hexanoyl-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 141176640 |
| Molecular Formula | C12H23NO7 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (2R,3S,4R,5R)-N-hexanoyl-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CCCCCC(=O)NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H23NO7/c1-2-3-4-5-8(16)13-12(20)11(19)10(18)9(17)7(15)6-14/h7,9-11,14-15,17-19H,2-6H2,1H3,(H,13,16,20)/t7-,9-,10+,11-/m1/s1 |
| InChIKey | PBOMBVRVDGMYLX-CZULRBLNSA-N |
| XLogP | -2.35 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|