C8H15NO7 — CID 18631221
(2R,3S,4S,5R)-N-acetyl-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 18631221) has the molecular formula C8H15NO7 and a molecular weight of 237.21 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-acetyl-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2R,3S,4S,5R)-N-acetyl-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 18631221 |
| Molecular Formula | C8H15NO7 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (2R,3S,4S,5R)-N-acetyl-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CC(=O)NC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H15NO7/c1-3(11)9-8(16)7(15)6(14)5(13)4(12)2-10/h4-7,10,12-15H,2H2,1H3,(H,9,11,16)/t4-,5+,6+,7-/m1/s1 |
| InChIKey | FRKYZIHMQZATAH-JRTVQGFMSA-N |
| XLogP | -3.91 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |