C7H16O7 — CID 174796405
3,4,5,6,7-pentahydroxyheptan-2-one;hydrate (PubChem CID 174796405) has the molecular formula C7H16O7 and a molecular weight of 212.20 g/mol. Its IUPAC name is 3,4,5,6,7-pentahydroxyheptan-2-one;hydrate.
| Compound Name | 3,4,5,6,7-pentahydroxyheptan-2-one;hydrate |
|---|---|
| PubChem CID | 174796405 |
| Molecular Formula | C7H16O7 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 3,4,5,6,7-pentahydroxyheptan-2-one;hydrate |
| SMILES | CC(=O)C(O)C(O)C(O)C(O)CO.O |
| InChI | InChI=1S/C7H14O6.H2O/c1-3(9)5(11)7(13)6(12)4(10)2-8;/h4-8,10-13H,2H2,1H3;1H2 |
| InChIKey | OVMJVNFAPMWAPS-UHFFFAOYSA-N |
| XLogP | -3.81 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |