C12H26O13 — CID 174726112
hexane-1,2,3,4,5,6-hexol;2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 174726112) has the molecular formula C12H26O13 and a molecular weight of 378.33 g/mol. Its IUPAC name is hexane-1,2,3,4,5,6-hexol;2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | hexane-1,2,3,4,5,6-hexol;2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 174726112 |
| Molecular Formula | C12H26O13 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | hexane-1,2,3,4,5,6-hexol;2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)CO.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O7.C6H14O6/c7-1-2(8)3(9)4(10)5(11)6(12)13;7-1-3(9)5(11)6(12)4(10)2-8/h2-5,7-11H,1H2,(H,12,13);3-12H,1-2H2 |
| InChIKey | CATATIHKPZQRRH-UHFFFAOYSA-N |
| XLogP | -7.08 |
| TPSA | 259.83 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | -7.08 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |