C11H24O12 — CID 175899129
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;(2S,4R)-pentane-1,2,3,4,5-pentol (PubChem CID 175899129) has the molecular formula C11H24O12 and a molecular weight of 348.30 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;(2S,4R)-pentane-1,2,3,4,5-pentol.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;(2S,4R)-pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 175899129 |
| Molecular Formula | C11H24O12 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;(2S,4R)-pentane-1,2,3,4,5-pentol |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@@H](O)C(O)[C@@H](O)CO |
| InChI | InChI=1S/C6H12O7.C5H12O5/c7-1-2(8)3(9)4(10)5(11)6(12)13;6-1-3(8)5(10)4(9)2-7/h2-5,7-11H,1H2,(H,12,13);3-10H,1-2H2/t2-,3-,4+,5-;3-,4+,5?/m1./s1 |
| InChIKey | NDTIOZMMILKFDM-DTACFEBYSA-N |
| XLogP | -6.44 |
| TPSA | 239.60 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -6.44 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |