(4R)-2,3,4,5,6-pentahydroxyhexanoic acid

C6H12O7 — CID 134944021

IUPAC(4R)-2,3,4,5,6-pentahydroxyhexanoic acid
SMILESO=C(O)C(O)C(O)[C@H](O)C(O)CO
InChIInChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2?,3-,4?,5?/m1/s1
InChIKeyRGHNJXZEOKUKBD-IKDMVZCSSA-N
MW196.16 g/mol
LogP-3.49
Rot. Bonds5

About (4R)-2,3,4,5,6-pentahydroxyhexanoic acid

(4R)-2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 134944021) has the molecular formula C6H12O7 and a molecular weight of 196.16 g/mol. Its IUPAC name is (4R)-2,3,4,5,6-pentahydroxyhexanoic acid.

Molecular Properties

Compound Name(4R)-2,3,4,5,6-pentahydroxyhexanoic acid
PubChem CID134944021
Molecular FormulaC6H12O7
Molecular Weight196.16 g/mol
Exact Mass196.06
IUPAC Name(4R)-2,3,4,5,6-pentahydroxyhexanoic acid
SMILESO=C(O)C(O)C(O)[C@H](O)C(O)CO
InChIInChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2?,3-,4?,5?/m1/s1
InChIKeyRGHNJXZEOKUKBD-IKDMVZCSSA-N
XLogP-3.49
TPSA138.45 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500196.16
LogP ≤ 5-3.49
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Analyze (4R)-2,3,4,5,6-pentahydroxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4R)-2,3,4,5,6-pentahydroxyhexanoic acid?
The IUPAC name of (4R)-2,3,4,5,6-pentahydroxyhexanoic acid (CID 134944021) is (4R)-2,3,4,5,6-pentahydroxyhexanoic acid.
What is the SMILES notation for (4R)-2,3,4,5,6-pentahydroxyhexanoic acid?
The canonical SMILES for (4R)-2,3,4,5,6-pentahydroxyhexanoic acid is O=C(O)C(O)C(O)[C@H](O)C(O)CO.
What is the InChIKey of (4R)-2,3,4,5,6-pentahydroxyhexanoic acid?
The InChIKey is RGHNJXZEOKUKBD-IKDMVZCSSA-N. The full InChI is InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2?,3-,4?,5?/m1/s1.
What are the key properties of (4R)-2,3,4,5,6-pentahydroxyhexanoic acid?
(4R)-2,3,4,5,6-pentahydroxyhexanoic acid has a molecular weight of 196.16 g/mol, XLogP of -3.49, 5 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,3,4,5,6-pentahydroxyhexanoic acid is sourced from PubChem (CID 134944021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).