C6H12O7Sm — CID 174356569
2,3,4,5,6-pentahydroxyhexanoic acid;samarium (PubChem CID 174356569) has the molecular formula C6H12O7Sm and a molecular weight of 346.52 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanoic acid;samarium.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanoic acid;samarium |
|---|---|
| PubChem CID | 174356569 |
| Molecular Formula | C6H12O7Sm |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanoic acid;samarium |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)CO.[Sm] |
| InChI | InChI=1S/C6H12O7.Sm/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13); |
| InChIKey | AUJORAZLBFCOQB-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |