C6H12Ac5O7 — CID 22966554
actinium;2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 22966554) has the molecular formula C6H12Ac5O7 and a molecular weight of 1331.16 g/mol. Its IUPAC name is actinium;2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | actinium;2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 22966554 |
| Molecular Formula | C6H12Ac5O7 |
| Molecular Weight | 1331.16 g/mol |
| Exact Mass | 1331.20 |
| IUPAC Name | actinium;2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)CO.[Ac].[Ac].[Ac].[Ac].[Ac] |
| InChI | InChI=1S/C6H12O7.5Ac/c7-1-2(8)3(9)4(10)5(11)6(12)13;;;;;/h2-5,7-11H,1H2,(H,12,13);;;;; |
| InChIKey | WSOSBCYEWFMTMS-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1331.16 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |