C12H24O14Ti — CID 132993109
bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid);titanium (PubChem CID 132993109) has the molecular formula C12H24O14Ti and a molecular weight of 440.18 g/mol. Its IUPAC name is bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid);titanium.
| Compound Name | bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid);titanium |
|---|---|
| PubChem CID | 132993109 |
| Molecular Formula | C12H24O14Ti |
| Molecular Weight | 440.18 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid);titanium |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Ti] |
| InChI | InChI=1S/2C6H12O7.Ti/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/t2*2-,3-,4+,5-;/m11./s1 |
| InChIKey | VXZUWDWQOVWHAJ-IYEMJOQQSA-N |
| XLogP | -6.99 |
| TPSA | 276.90 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.18 |
| LogP ≤ 5 | -6.99 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |