(2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid

C7H14O8 — CID 3084118

IUPAC(2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid
SMILESO=C(O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)CO
InChIInChI=1S/C7H14O8/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15/h2-6,8-13H,1H2,(H,14,15)/t2-,3-,4-,5-,6-/m0/s1
InChIKeyKWMLJOLKUYYJFJ-RUTHBDMASA-N
MW226.18 g/mol
LogP-4.13
Rot. Bonds6

About (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid

(2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid (PubChem CID 3084118) has the molecular formula C7H14O8 and a molecular weight of 226.18 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid.

Molecular Properties

Compound Name(2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid
PubChem CID3084118
Molecular FormulaC7H14O8
Molecular Weight226.18 g/mol
Exact Mass226.07
IUPAC Name(2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid
SMILESO=C(O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)CO
InChIInChI=1S/C7H14O8/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15/h2-6,8-13H,1H2,(H,14,15)/t2-,3-,4-,5-,6-/m0/s1
InChIKeyKWMLJOLKUYYJFJ-RUTHBDMASA-N
XLogP-4.13
TPSA158.68 Ų
H-Bond Donors7
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500226.18
LogP ≤ 5-4.13
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 107

Analyze (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid?
The IUPAC name of (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid (CID 3084118) is (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid.
What is the SMILES notation for (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid?
The canonical SMILES for (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid is O=C(O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)CO.
What is the InChIKey of (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid?
The InChIKey is KWMLJOLKUYYJFJ-RUTHBDMASA-N. The full InChI is InChI=1S/C7H14O8/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15/h2-6,8-13H,1H2,(H,14,15)/t2-,3-,4-,5-,6-/m0/s1.
What are the key properties of (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid?
(2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid has a molecular weight of 226.18 g/mol, XLogP of -4.13, 6 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid is sourced from PubChem (CID 3084118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).