C7H14O8 — CID 3084118
(2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid (PubChem CID 3084118) has the molecular formula C7H14O8 and a molecular weight of 226.18 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid.
| Compound Name | (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid |
|---|---|
| PubChem CID | 3084118 |
| Molecular Formula | C7H14O8 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (2S,3S,4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptanoic acid |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C7H14O8/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15/h2-6,8-13H,1H2,(H,14,15)/t2-,3-,4-,5-,6-/m0/s1 |
| InChIKey | KWMLJOLKUYYJFJ-RUTHBDMASA-N |
| XLogP | -4.13 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |