C12H24O9 — CID 174325080
2,3,4,5,6-pentahydroxyhexanoic acid;bis(propan-2-one) (PubChem CID 174325080) has the molecular formula C12H24O9 and a molecular weight of 312.32 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanoic acid;bis(propan-2-one).
| Compound Name | 2,3,4,5,6-pentahydroxyhexanoic acid;bis(propan-2-one) |
|---|---|
| PubChem CID | 174325080 |
| Molecular Formula | C12H24O9 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanoic acid;bis(propan-2-one) |
| SMILES | CC(C)=O.CC(C)=O.O=C(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O7.2C3H6O/c7-1-2(8)3(9)4(10)5(11)6(12)13;2*1-3(2)4/h2-5,7-11H,1H2,(H,12,13);2*1-2H3 |
| InChIKey | FHZFEYUZNZQFFU-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |