C8H14O7 — CID 87065543
(4R,5S,6S,7R)-4,5,6,7,8-pentahydroxyoctane-2,3-dione (PubChem CID 87065543) has the molecular formula C8H14O7 and a molecular weight of 222.19 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,5,6,7,8-pentahydroxyoctane-2,3-dione.
| Compound Name | (4R,5S,6S,7R)-4,5,6,7,8-pentahydroxyoctane-2,3-dione |
|---|---|
| PubChem CID | 87065543 |
| Molecular Formula | C8H14O7 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (4R,5S,6S,7R)-4,5,6,7,8-pentahydroxyoctane-2,3-dione |
| SMILES | CC(=O)C(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H14O7/c1-3(10)5(12)7(14)8(15)6(13)4(11)2-9/h4,6-9,11,13-15H,2H2,1H3/t4-,6+,7+,8+/m1/s1 |
| InChIKey | HXBYBCASAVUYKF-YTQLPXDHSA-N |
| XLogP | -3.42 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|