C7H13NO7 — CID 174921304
3,4,5,6,7-pentahydroxy-2-oxoheptanamide (PubChem CID 174921304) has the molecular formula C7H13NO7 and a molecular weight of 223.18 g/mol. Its IUPAC name is 3,4,5,6,7-pentahydroxy-2-oxoheptanamide.
| Compound Name | 3,4,5,6,7-pentahydroxy-2-oxoheptanamide |
|---|---|
| PubChem CID | 174921304 |
| Molecular Formula | C7H13NO7 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 3,4,5,6,7-pentahydroxy-2-oxoheptanamide |
| SMILES | NC(=O)C(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C7H13NO7/c8-7(15)6(14)5(13)4(12)3(11)2(10)1-9/h2-5,9-13H,1H2,(H2,8,15) |
| InChIKey | XVHLJDXPYBAJQY-UHFFFAOYSA-N |
| XLogP | -4.52 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|