C6H15NO10S — CID 174474944
2,3,4,5,6-pentahydroxyhexanamide;sulfuric acid (PubChem CID 174474944) has the molecular formula C6H15NO10S and a molecular weight of 293.25 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanamide;sulfuric acid.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanamide;sulfuric acid |
|---|---|
| PubChem CID | 174474944 |
| Molecular Formula | C6H15NO10S |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanamide;sulfuric acid |
| SMILES | NC(=O)C(O)C(O)C(O)C(O)CO.O=S(=O)(O)O |
| InChI | InChI=1S/C6H13NO6.H2O4S/c7-6(13)5(12)4(11)3(10)2(9)1-8;1-5(2,3)4/h2-5,8-12H,1H2,(H2,7,13);(H2,1,2,3,4) |
| InChIKey | USDAQJSRGJCNNX-UHFFFAOYSA-N |
| XLogP | -4.75 |
| TPSA | 218.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|