C6H17O15PS — CID 174408519
2,3,4,5,6-pentahydroxyhexanoic acid;phosphoric acid;sulfuric acid (PubChem CID 174408519) has the molecular formula C6H17O15PS and a molecular weight of 392.23 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanoic acid;phosphoric acid;sulfuric acid.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanoic acid;phosphoric acid;sulfuric acid |
|---|---|
| PubChem CID | 174408519 |
| Molecular Formula | C6H17O15PS |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanoic acid;phosphoric acid;sulfuric acid |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)CO.O=P(O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C6H12O7.H3O4P.H2O4S/c7-1-2(8)3(9)4(10)5(11)6(12)13;2*1-5(2,3)4/h2-5,7-11H,1H2,(H,12,13);(H3,1,2,3,4);(H2,1,2,3,4) |
| InChIKey | BBBYTPMNYJARBP-UHFFFAOYSA-N |
| XLogP | -5.07 |
| TPSA | 290.81 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | -5.07 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|